C21H17N3O3S2 — CID 22301256
S-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamoylamino] thiophene-2-carbothioate (PubChem CID 22301256) has the molecular formula C21H17N3O3S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is S-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamoylamino] thiophene-2-carbothioate.
| Compound Name | S-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamoylamino] thiophene-2-carbothioate |
|---|---|
| PubChem CID | 22301256 |
| Molecular Formula | C21H17N3O3S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | S-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamoylamino] thiophene-2-carbothioate |
| SMILES | Cc1ccc2oc(-c3ccc(C)c(NC(=O)NSC(=O)c4cccs4)c3)nc2c1 |
| InChI | InChI=1S/C21H17N3O3S2/c1-12-5-8-17-16(10-12)22-19(27-17)14-7-6-13(2)15(11-14)23-21(26)24-29-20(25)18-4-3-9-28-18/h3-11H,1-2H3,(H2,23,24,26) |
| InChIKey | IQYZNTNFUYANEL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|