C13H19BrN2O3S — CID 22301493
2-[(3-bromophenyl)methylsulfonylamino]-N,N-diethylacetamide (PubChem CID 22301493) has the molecular formula C13H19BrN2O3S and a molecular weight of 363.28 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfonylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfonylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 22301493 |
| Molecular Formula | C13H19BrN2O3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfonylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNS(=O)(=O)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H19BrN2O3S/c1-3-16(4-2)13(17)9-15-20(18,19)10-11-6-5-7-12(14)8-11/h5-8,15H,3-4,9-10H2,1-2H3 |
| InChIKey | DKHYMFOHBHMCDQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |