methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate

C13H11NO3S — CID 22301891

IUPACmethyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate
SMILESCOC(=O)/C=C1/SC(Cc2ccccc2)=NC1=O
InChIInChI=1S/C13H11NO3S/c1-17-12(15)8-10-13(16)14-11(18-10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/b10-8+
InChIKeySOCLMTGJNXCSAS-CSKARUKUSA-N
MW261.30 g/mol
LogP1.96
Rot. Bonds3

About methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate

methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate (PubChem CID 22301891) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate.

Molecular Properties

Compound Namemethyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate
PubChem CID22301891
Molecular FormulaC13H11NO3S
Molecular Weight261.30 g/mol
Exact Mass261.05
IUPAC Namemethyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate
SMILESCOC(=O)/C=C1/SC(Cc2ccccc2)=NC1=O
InChIInChI=1S/C13H11NO3S/c1-17-12(15)8-10-13(16)14-11(18-10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/b10-8+
InChIKeySOCLMTGJNXCSAS-CSKARUKUSA-N
XLogP1.96
TPSA55.73 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.30
LogP ≤ 51.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate?
The IUPAC name of methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate (CID 22301891) is methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate.
What is the SMILES notation for methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate?
The canonical SMILES for methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate is COC(=O)/C=C1/SC(Cc2ccccc2)=NC1=O.
What is the InChIKey of methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate?
The InChIKey is SOCLMTGJNXCSAS-CSKARUKUSA-N. The full InChI is InChI=1S/C13H11NO3S/c1-17-12(15)8-10-13(16)14-11(18-10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/b10-8+.
What are the key properties of methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate?
methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate has a molecular weight of 261.30 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate is sourced from PubChem (CID 22301891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).