C13H11NO3S — CID 22301891
methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate (PubChem CID 22301891) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate.
| Compound Name | methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate |
|---|---|
| PubChem CID | 22301891 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | methyl (2E)-2-(2-benzyl-4-oxo-1,3-thiazol-5-ylidene)acetate |
| SMILES | COC(=O)/C=C1/SC(Cc2ccccc2)=NC1=O |
| InChI | InChI=1S/C13H11NO3S/c1-17-12(15)8-10-13(16)14-11(18-10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/b10-8+ |
| InChIKey | SOCLMTGJNXCSAS-CSKARUKUSA-N |
| XLogP | 1.96 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|