C19H14N2O4S — CID 139669889
methyl 2-[2-(N-benzoylanilino)-4-oxo-1,3-thiazol-5-ylidene]acetate (PubChem CID 139669889) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is methyl 2-[2-(N-benzoylanilino)-4-oxo-1,3-thiazol-5-ylidene]acetate.
| Compound Name | methyl 2-[2-(N-benzoylanilino)-4-oxo-1,3-thiazol-5-ylidene]acetate |
|---|---|
| PubChem CID | 139669889 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | methyl 2-[2-(N-benzoylanilino)-4-oxo-1,3-thiazol-5-ylidene]acetate |
| SMILES | COC(=O)C=C1SC(N(C(=O)c2ccccc2)c2ccccc2)=NC1=O |
| InChI | InChI=1S/C19H14N2O4S/c1-25-16(22)12-15-17(23)20-19(26-15)21(14-10-6-3-7-11-14)18(24)13-8-4-2-5-9-13/h2-12H,1H3 |
| InChIKey | ATLSROUWMCXCRA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|