C6H5NO3S — CID 142246626
methyl (2Z)-2-(4-oxo-1,3-thiazol-5-ylidene)acetate (PubChem CID 142246626) has the molecular formula C6H5NO3S and a molecular weight of 171.18 g/mol. Its IUPAC name is methyl (2Z)-2-(4-oxo-1,3-thiazol-5-ylidene)acetate.
| Compound Name | methyl (2Z)-2-(4-oxo-1,3-thiazol-5-ylidene)acetate |
|---|---|
| PubChem CID | 142246626 |
| Molecular Formula | C6H5NO3S |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | methyl (2Z)-2-(4-oxo-1,3-thiazol-5-ylidene)acetate |
| SMILES | COC(=O)/C=C1\SC=NC1=O |
| InChI | InChI=1S/C6H5NO3S/c1-10-5(8)2-4-6(9)7-3-11-4/h2-3H,1H3/b4-2- |
| InChIKey | DGRVOUAGBQGEOA-RQOWECAXSA-N |
| XLogP | 0.34 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|