C17H15Cl2N7O2S — CID 22302744
1-[[2-[5-(2,3-dichlorophenyl)tetrazol-2-yl]acetyl]amino]-1-(4-methoxyphenyl)thiourea (PubChem CID 22302744) has the molecular formula C17H15Cl2N7O2S and a molecular weight of 452.33 g/mol. Its IUPAC name is 1-[[2-[5-(2,3-dichlorophenyl)tetrazol-2-yl]acetyl]amino]-1-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[[2-[5-(2,3-dichlorophenyl)tetrazol-2-yl]acetyl]amino]-1-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 22302744 |
| Molecular Formula | C17H15Cl2N7O2S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 1-[[2-[5-(2,3-dichlorophenyl)tetrazol-2-yl]acetyl]amino]-1-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(N(NC(=O)Cn2nnc(-c3cccc(Cl)c3Cl)n2)C(N)=S)cc1 |
| InChI | InChI=1S/C17H15Cl2N7O2S/c1-28-11-7-5-10(6-8-11)26(17(20)29)22-14(27)9-25-23-16(21-24-25)12-3-2-4-13(18)15(12)19/h2-8H,9H2,1H3,(H2,20,29)(H,22,27) |
| InChIKey | QENUCRSHYLZFSP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|