C19H22N4O3S2 — CID 22303299
1-[[1-(benzenesulfonyl)piperidine-3-carbonyl]amino]-1-phenylthiourea (PubChem CID 22303299) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidine-3-carbonyl]amino]-1-phenylthiourea.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidine-3-carbonyl]amino]-1-phenylthiourea |
|---|---|
| PubChem CID | 22303299 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidine-3-carbonyl]amino]-1-phenylthiourea |
| SMILES | NC(=S)N(NC(=O)C1CCCN(S(=O)(=O)c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C19H22N4O3S2/c20-19(27)23(16-9-3-1-4-10-16)21-18(24)15-8-7-13-22(14-15)28(25,26)17-11-5-2-6-12-17/h1-6,9-12,15H,7-8,13-14H2,(H2,20,27)(H,21,24) |
| InChIKey | ZJQRXKMZGAVYMF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|