C22H28N2O5S — CID 22303956
2-[2-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-cyclohexylacetamide (PubChem CID 22303956) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-cyclohexylacetamide.
| Compound Name | 2-[2-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 22303956 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-cyclohexylacetamide |
| SMILES | COc1ccc(NCC(=O)NC2CCCCC2)c(S(=O)(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C22H28N2O5S/c1-28-19-14-13-18(23-15-20(25)24-16-9-5-3-6-10-16)22(21(19)29-2)30(26,27)17-11-7-4-8-12-17/h4,7-8,11-14,16,23H,3,5-6,9-10,15H2,1-2H3,(H,24,25) |
| InChIKey | XOAZKFDGGURJFS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|