C24H26N2O6S — CID 22307389
2-[2-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 22307389) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[2-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 22307389 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CNc2ccc(OC)c(OC)c2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2O6S/c1-30-18-11-9-17(10-12-18)15-26-22(27)16-25-20-13-14-21(31-2)23(32-3)24(20)33(28,29)19-7-5-4-6-8-19/h4-14,25H,15-16H2,1-3H3,(H,26,27) |
| InChIKey | PWHYUAWFROCDMU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|