C19H24N2O5S — CID 22305132
2-[3-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-propylacetamide (PubChem CID 22305132) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-propylacetamide.
| Compound Name | 2-[3-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-propylacetamide |
|---|---|
| PubChem CID | 22305132 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-2,4-dimethoxyanilino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNc1ccc(OC)c(S(=O)(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C19H24N2O5S/c1-4-12-20-17(22)13-21-15-10-11-16(25-2)19(18(15)26-3)27(23,24)14-8-6-5-7-9-14/h5-11,21H,4,12-13H2,1-3H3,(H,20,22) |
| InChIKey | BBMNJSOETIRKKU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|