C23H30N2O5S — CID 22304403
N-cyclohexyl-2-[2,4-dimethoxy-3-(4-methylphenyl)sulfonylanilino]acetamide (PubChem CID 22304403) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-cyclohexyl-2-[2,4-dimethoxy-3-(4-methylphenyl)sulfonylanilino]acetamide.
| Compound Name | N-cyclohexyl-2-[2,4-dimethoxy-3-(4-methylphenyl)sulfonylanilino]acetamide |
|---|---|
| PubChem CID | 22304403 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-cyclohexyl-2-[2,4-dimethoxy-3-(4-methylphenyl)sulfonylanilino]acetamide |
| SMILES | COc1ccc(NCC(=O)NC2CCCCC2)c(OC)c1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30N2O5S/c1-16-9-11-18(12-10-16)31(27,28)23-20(29-2)14-13-19(22(23)30-3)24-15-21(26)25-17-7-5-4-6-8-17/h9-14,17,24H,4-8,15H2,1-3H3,(H,25,26) |
| InChIKey | PPZXKYOLTMXLLV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|