C26H21F3N2O3S — CID 22304717
2-[2-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-naphthalen-2-ylacetamide (PubChem CID 22304717) has the molecular formula C26H21F3N2O3S and a molecular weight of 498.53 g/mol. Its IUPAC name is 2-[2-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[2-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 22304717 |
| Molecular Formula | C26H21F3N2O3S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-[2-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-naphthalen-2-ylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)c2c(NCC(=O)Nc3ccc4ccccc4c3)cccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H21F3N2O3S/c1-17-9-13-21(14-10-17)35(33,34)25-22(26(27,28)29)7-4-8-23(25)30-16-24(32)31-20-12-11-18-5-2-3-6-19(18)15-20/h2-15,30H,16H2,1H3,(H,31,32) |
| InChIKey | FBXPSWCLCBFVHO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |