C21H17Cl2IN2O3S — CID 22305203
2-[3-chloro-2-(4-chlorophenyl)sulfonylanilino]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 22305203) has the molecular formula C21H17Cl2IN2O3S and a molecular weight of 575.26 g/mol. Its IUPAC name is 2-[3-chloro-2-(4-chlorophenyl)sulfonylanilino]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[3-chloro-2-(4-chlorophenyl)sulfonylanilino]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 22305203 |
| Molecular Formula | C21H17Cl2IN2O3S |
| Molecular Weight | 575.26 g/mol |
| Exact Mass | 573.94 |
| IUPAC Name | 2-[3-chloro-2-(4-chlorophenyl)sulfonylanilino]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CNc1cccc(Cl)c1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17Cl2IN2O3S/c1-13-11-15(24)7-10-18(13)26-20(27)12-25-19-4-2-3-17(23)21(19)30(28,29)16-8-5-14(22)6-9-16/h2-11,25H,12H2,1H3,(H,26,27) |
| InChIKey | DEUSENXKXYXYPN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.26 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|