C14H16N6O3S — CID 22305999
1-ethyl-1-[[4-[(4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiourea (PubChem CID 22305999) has the molecular formula C14H16N6O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-ethyl-1-[[4-[(4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiourea.
| Compound Name | 1-ethyl-1-[[4-[(4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 22305999 |
| Molecular Formula | C14H16N6O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1-ethyl-1-[[4-[(4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiourea |
| SMILES | CCN(NC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)cc1)C(N)=S |
| InChI | InChI=1S/C14H16N6O3S/c1-2-19(14(15)24)17-13(21)11-5-3-10(4-6-11)8-18-9-12(7-16-18)20(22)23/h3-7,9H,2,8H2,1H3,(H2,15,24)(H,17,21) |
| InChIKey | WBXKUTKEAUMIMD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|