C27H31N3O5S — CID 22307610
2-[[2-[3-(benzenesulfonyl)-2-methoxy-5-methylanilino]acetyl]amino]-N-butan-2-ylbenzamide (PubChem CID 22307610) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is 2-[[2-[3-(benzenesulfonyl)-2-methoxy-5-methylanilino]acetyl]amino]-N-butan-2-ylbenzamide.
| Compound Name | 2-[[2-[3-(benzenesulfonyl)-2-methoxy-5-methylanilino]acetyl]amino]-N-butan-2-ylbenzamide |
|---|---|
| PubChem CID | 22307610 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 2-[[2-[3-(benzenesulfonyl)-2-methoxy-5-methylanilino]acetyl]amino]-N-butan-2-ylbenzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)CNc1cc(C)cc(S(=O)(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C27H31N3O5S/c1-5-19(3)29-27(32)21-13-9-10-14-22(21)30-25(31)17-28-23-15-18(2)16-24(26(23)35-4)36(33,34)20-11-7-6-8-12-20/h6-16,19,28H,5,17H2,1-4H3,(H,29,32)(H,30,31) |
| InChIKey | GQEHUJXTQHUXHY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |