C16H13F3N6OS — CID 22307824
1-[[2-(benzotriazol-1-yl)acetyl]amino]-1-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 22307824) has the molecular formula C16H13F3N6OS and a molecular weight of 394.38 g/mol. Its IUPAC name is 1-[[2-(benzotriazol-1-yl)acetyl]amino]-1-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[[2-(benzotriazol-1-yl)acetyl]amino]-1-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 22307824 |
| Molecular Formula | C16H13F3N6OS |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-[[2-(benzotriazol-1-yl)acetyl]amino]-1-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | NC(=S)N(NC(=O)Cn1nnc2ccccc21)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N6OS/c17-16(18,19)10-4-3-5-11(8-10)25(15(20)27)22-14(26)9-24-13-7-2-1-6-12(13)21-23-24/h1-8H,9H2,(H2,20,27)(H,22,26) |
| InChIKey | KTVVKACOBVOFOS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|