C21H17F3N4O2S — CID 20850313
1-[[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carbonyl]amino]-1-phenylthiourea (PubChem CID 20850313) has the molecular formula C21H17F3N4O2S and a molecular weight of 446.45 g/mol. Its IUPAC name is 1-[[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carbonyl]amino]-1-phenylthiourea.
| Compound Name | 1-[[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carbonyl]amino]-1-phenylthiourea |
|---|---|
| PubChem CID | 20850313 |
| Molecular Formula | C21H17F3N4O2S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-[[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carbonyl]amino]-1-phenylthiourea |
| SMILES | NC(=S)N(NC(=O)c1cccn(Cc2cccc(C(F)(F)F)c2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C21H17F3N4O2S/c22-21(23,24)15-7-4-6-14(12-15)13-27-11-5-10-17(19(27)30)18(29)26-28(20(25)31)16-8-2-1-3-9-16/h1-12H,13H2,(H2,25,31)(H,26,29) |
| InChIKey | AVCMESQAOBIJFQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|