C20H25N3O6 — CID 22313378
N-(1-azabicyclo[2.2.2]octan-3-yl)-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxamide;(E)-but-2-enedioic acid (PubChem CID 22313378) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxamide;(E)-but-2-enedioic acid.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 22313378 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxamide;(E)-but-2-enedioic acid |
| SMILES | O=C(NC1CN2CCC1CC2)c1cc2c(cn1)OCCC2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H21N3O2.C4H4O4/c20-16(18-14-10-19-5-3-11(14)4-6-19)13-8-12-2-1-7-21-15(12)9-17-13;5-3(6)1-2-4(7)8/h8-9,11,14H,1-7,10H2,(H,18,20);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RGLAHUXWEDDOBE-WLHGVMLRSA-N |
| XLogP | 0.94 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|