C21H24N2O6 — CID 23394132
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2H-chromene-6-carboxamide;(E)-but-2-enedioic acid (PubChem CID 23394132) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2H-chromene-6-carboxamide;(E)-but-2-enedioic acid.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2H-chromene-6-carboxamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 23394132 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2H-chromene-6-carboxamide;(E)-but-2-enedioic acid |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1ccc2c(c1)C=CCO2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H20N2O2.C4H4O4/c20-17(18-15-11-19-7-5-12(15)6-8-19)14-3-4-16-13(10-14)2-1-9-21-16;5-3(6)1-2-4(7)8/h1-4,10,12,15H,5-9,11H2,(H,18,20);1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-;/m0./s1 |
| InChIKey | NOZPSDDRDQRTAG-YAKGRJRBSA-N |
| XLogP | 1.63 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|