C21H25N3O5 — CID 10046469
N-(1-azabicyclo[2.2.2]octan-3-yl)-1-methylindole-5-carboxamide;(E)-but-2-enedioic acid (PubChem CID 10046469) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-1-methylindole-5-carboxamide;(E)-but-2-enedioic acid.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-1-methylindole-5-carboxamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 10046469 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-1-methylindole-5-carboxamide;(E)-but-2-enedioic acid |
| SMILES | Cn1ccc2cc(C(=O)NC3CN4CCC3CC4)ccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H21N3O.C4H4O4/c1-19-7-4-13-10-14(2-3-16(13)19)17(21)18-15-11-20-8-5-12(15)6-9-20;5-3(6)1-2-4(7)8/h2-4,7,10,12,15H,5-6,8-9,11H2,1H3,(H,18,21);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HYIVFOZSDNUKSJ-WLHGVMLRSA-N |
| XLogP | 1.71 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|