C20H25N3O4 — CID 91309214
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-methyl-1,3-benzoxazole-5-carboxamide;(E)-but-2-enoic acid (PubChem CID 91309214) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-methyl-1,3-benzoxazole-5-carboxamide;(E)-but-2-enoic acid.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-methyl-1,3-benzoxazole-5-carboxamide;(E)-but-2-enoic acid |
|---|---|
| PubChem CID | 91309214 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-methyl-1,3-benzoxazole-5-carboxamide;(E)-but-2-enoic acid |
| SMILES | C/C=C/C(=O)O.Cc1nc2cc(C(=O)N[C@H]3CN4CCC3CC4)ccc2o1 |
| InChI | InChI=1S/C16H19N3O2.C4H6O2/c1-10-17-13-8-12(2-3-15(13)21-10)16(20)18-14-9-19-6-4-11(14)5-7-19;1-2-3-4(5)6/h2-3,8,11,14H,4-7,9H2,1H3,(H,18,20);2-3H,1H3,(H,5,6)/b;3-2+/t14-;/m0./s1 |
| InChIKey | XCLBLDIAKOGMLC-SRTPQFSBSA-N |
| XLogP | 2.61 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|