C28H33N3O2S — CID 22314112
2-[ethyl-[4-[[3-[4-(N-methylanilino)phenyl]-1,2-benzothiazol-6-yl]oxy]butyl]amino]ethanol (PubChem CID 22314112) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is 2-[ethyl-[4-[[3-[4-(N-methylanilino)phenyl]-1,2-benzothiazol-6-yl]oxy]butyl]amino]ethanol.
| Compound Name | 2-[ethyl-[4-[[3-[4-(N-methylanilino)phenyl]-1,2-benzothiazol-6-yl]oxy]butyl]amino]ethanol |
|---|---|
| PubChem CID | 22314112 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2-[ethyl-[4-[[3-[4-(N-methylanilino)phenyl]-1,2-benzothiazol-6-yl]oxy]butyl]amino]ethanol |
| SMILES | CCN(CCO)CCCCOc1ccc2c(-c3ccc(N(C)c4ccccc4)cc3)nsc2c1 |
| InChI | InChI=1S/C28H33N3O2S/c1-3-31(18-19-32)17-7-8-20-33-25-15-16-26-27(21-25)34-29-28(26)22-11-13-24(14-12-22)30(2)23-9-5-4-6-10-23/h4-6,9-16,21,32H,3,7-8,17-20H2,1-2H3 |
| InChIKey | KJDFXSWVTCDUEA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|