C23H29BrN2OS — CID 70009806
N-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl]-N-methylpentan-1-amine (PubChem CID 70009806) has the molecular formula C23H29BrN2OS and a molecular weight of 461.47 g/mol. Its IUPAC name is N-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl]-N-methylpentan-1-amine.
| Compound Name | N-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 70009806 |
| Molecular Formula | C23H29BrN2OS |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl]-N-methylpentan-1-amine |
| SMILES | CCCCCN(C)CCCCOc1ccc2c(-c3ccc(Br)cc3)nsc2c1 |
| InChI | InChI=1S/C23H29BrN2OS/c1-3-4-5-14-26(2)15-6-7-16-27-20-12-13-21-22(17-20)28-25-23(21)18-8-10-19(24)11-9-18/h8-13,17H,3-7,14-16H2,1-2H3 |
| InChIKey | SJXXFCHKLAZIJP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|