C20H21BrN2OS — CID 22314121
6-[4-(azetidin-1-yl)butoxy]-3-(4-bromophenyl)-1,2-benzothiazole (PubChem CID 22314121) has the molecular formula C20H21BrN2OS and a molecular weight of 417.37 g/mol. Its IUPAC name is 6-[4-(azetidin-1-yl)butoxy]-3-(4-bromophenyl)-1,2-benzothiazole.
| Compound Name | 6-[4-(azetidin-1-yl)butoxy]-3-(4-bromophenyl)-1,2-benzothiazole |
|---|---|
| PubChem CID | 22314121 |
| Molecular Formula | C20H21BrN2OS |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 6-[4-(azetidin-1-yl)butoxy]-3-(4-bromophenyl)-1,2-benzothiazole |
| SMILES | Brc1ccc(-c2nsc3cc(OCCCCN4CCC4)ccc23)cc1 |
| InChI | InChI=1S/C20H21BrN2OS/c21-16-6-4-15(5-7-16)20-18-9-8-17(14-19(18)25-22-20)24-13-2-1-10-23-11-3-12-23/h4-9,14H,1-3,10-13H2 |
| InChIKey | QOOHFWYXYUUMAF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|