C21H25BrN2O3S — CID 10226776
2-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 10226776) has the molecular formula C21H25BrN2O3S and a molecular weight of 465.41 g/mol. Its IUPAC name is 2-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 10226776 |
| Molecular Formula | C21H25BrN2O3S |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 2-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | OCCN(CCO)CCCCOc1ccc2c(-c3ccc(Br)cc3)nsc2c1 |
| InChI | InChI=1S/C21H25BrN2O3S/c22-17-5-3-16(4-6-17)21-19-8-7-18(15-20(19)28-23-21)27-14-2-1-9-24(10-12-25)11-13-26/h3-8,15,25-26H,1-2,9-14H2 |
| InChIKey | LJYMMGAXOLXEQQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|