C21H23BrN2S — CID 22313888
4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N-methyl-N-prop-2-enylbutan-1-amine (PubChem CID 22313888) has the molecular formula C21H23BrN2S and a molecular weight of 415.40 g/mol. Its IUPAC name is 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N-methyl-N-prop-2-enylbutan-1-amine.
| Compound Name | 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N-methyl-N-prop-2-enylbutan-1-amine |
|---|---|
| PubChem CID | 22313888 |
| Molecular Formula | C21H23BrN2S |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N-methyl-N-prop-2-enylbutan-1-amine |
| SMILES | C=CCN(C)CCCCc1ccc2c(-c3ccc(Br)cc3)nsc2c1 |
| InChI | InChI=1S/C21H23BrN2S/c1-3-13-24(2)14-5-4-6-16-7-12-19-20(15-16)25-23-21(19)17-8-10-18(22)11-9-17/h3,7-12,15H,1,4-6,13-14H2,2H3 |
| InChIKey | BVQDBMLSCKFWMA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|