C22H23BrNO4PS — CID 69289237
[4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-2-methylbut-3-yn-2-yl] diethyl phosphate (PubChem CID 69289237) has the molecular formula C22H23BrNO4PS and a molecular weight of 508.37 g/mol. Its IUPAC name is [4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-2-methylbut-3-yn-2-yl] diethyl phosphate.
| Compound Name | [4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-2-methylbut-3-yn-2-yl] diethyl phosphate |
|---|---|
| PubChem CID | 69289237 |
| Molecular Formula | C22H23BrNO4PS |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | [4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-2-methylbut-3-yn-2-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC(C)(C)C#Cc1ccc2c(-c3ccc(Br)cc3)nsc2c1 |
| InChI | InChI=1S/C22H23BrNO4PS/c1-5-26-29(25,27-6-2)28-22(3,4)14-13-16-7-12-19-20(15-16)30-24-21(19)17-8-10-18(23)11-9-17/h7-12,15H,5-6H2,1-4H3 |
| InChIKey | KBTYDRXWTCWMDF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|