About 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine
4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine (PubChem CID 22314096) has the molecular formula C19H21BrN2S
and a molecular weight of 389.36 g/mol. Its IUPAC name is 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine |
| PubChem CID | 22314096 |
| Molecular Formula | C19H21BrN2S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCc1ccc2c(-c3ccc(Br)cc3)nsc2c1 |
| InChI | InChI=1S/C19H21BrN2S/c1-22(2)12-4-3-5-14-6-11-17-18(13-14)23-21-19(17)15-7-9-16(20)10-8-15/h6-11,13H,3-5,12H2,1-2H3 |
| InChIKey | GPFBISWBRBSDIQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine?
The IUPAC name of 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine (CID 22314096) is 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine.
What is the SMILES notation for 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine?
The canonical SMILES for 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine is CN(C)CCCCc1ccc2c(-c3ccc(Br)cc3)nsc2c1.
What is the InChIKey of 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine?
The InChIKey is GPFBISWBRBSDIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21BrN2S/c1-22(2)12-4-3-5-14-6-11-17-18(13-14)23-21-19(17)15-7-9-16(20)10-8-15/h6-11,13H,3-5,12H2,1-2H3.
What are the key properties of 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine?
4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine has a molecular weight of 389.36 g/mol, XLogP of 5.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine is sourced from PubChem (CID 22314096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).