C19H21BrN2S — CID 22314096
4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine (PubChem CID 22314096) has the molecular formula C19H21BrN2S and a molecular weight of 389.36 g/mol. Its IUPAC name is 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 22314096 |
| Molecular Formula | C19H21BrN2S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCc1ccc2c(-c3ccc(Br)cc3)nsc2c1 |
| InChI | InChI=1S/C19H21BrN2S/c1-22(2)12-4-3-5-14-6-11-17-18(13-14)23-21-19(17)15-7-9-16(20)10-8-15/h6-11,13H,3-5,12H2,1-2H3 |
| InChIKey | GPFBISWBRBSDIQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|