C24H30BrNO3S — CID 22314203
4-[[3-(4-bromophenyl)-1-benzothiophen-6-yl]oxy]-N,N-bis(2-methoxyethyl)butan-1-amine (PubChem CID 22314203) has the molecular formula C24H30BrNO3S and a molecular weight of 492.48 g/mol. Its IUPAC name is 4-[[3-(4-bromophenyl)-1-benzothiophen-6-yl]oxy]-N,N-bis(2-methoxyethyl)butan-1-amine.
| Compound Name | 4-[[3-(4-bromophenyl)-1-benzothiophen-6-yl]oxy]-N,N-bis(2-methoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 22314203 |
| Molecular Formula | C24H30BrNO3S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 4-[[3-(4-bromophenyl)-1-benzothiophen-6-yl]oxy]-N,N-bis(2-methoxyethyl)butan-1-amine |
| SMILES | COCCN(CCCCOc1ccc2c(-c3ccc(Br)cc3)csc2c1)CCOC |
| InChI | InChI=1S/C24H30BrNO3S/c1-27-15-12-26(13-16-28-2)11-3-4-14-29-21-9-10-22-23(18-30-24(22)17-21)19-5-7-20(25)8-6-19/h5-10,17-18H,3-4,11-16H2,1-2H3 |
| InChIKey | SYHMVCIBGUACMV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|