C35H37N3O4 — CID 22314703
6-[6-[[1-(4-methoxyphenyl)-2-methylidene-1-phenylbut-3-enyl]amino]hexanoyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylic acid (PubChem CID 22314703) has the molecular formula C35H37N3O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is 6-[6-[[1-(4-methoxyphenyl)-2-methylidene-1-phenylbut-3-enyl]amino]hexanoyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylic acid.
| Compound Name | 6-[6-[[1-(4-methoxyphenyl)-2-methylidene-1-phenylbut-3-enyl]amino]hexanoyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22314703 |
| Molecular Formula | C35H37N3O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 6-[6-[[1-(4-methoxyphenyl)-2-methylidene-1-phenylbut-3-enyl]amino]hexanoyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylic acid |
| SMILES | C=CC(=C)C(NCCCCCC(=O)N1CCc2c1ccc1[nH]c(C(=O)O)cc21)(c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C35H37N3O4/c1-4-24(2)35(25-11-7-5-8-12-25,26-14-16-27(42-3)17-15-26)36-21-10-6-9-13-33(39)38-22-20-28-29-23-31(34(40)41)37-30(29)18-19-32(28)38/h4-5,7-8,11-12,14-19,23,36-37H,1-2,6,9-10,13,20-22H2,3H3,(H,40,41) |
| InChIKey | IGBBRPRZRUGXFQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|