C30H33NO6 — CID 22325285
2-[[4-[3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxopropyl]phenyl]methyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 22325285) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-[[4-[3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxopropyl]phenyl]methyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[[4-[3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxopropyl]phenyl]methyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 22325285 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 2-[[4-[3-(4-hydroxy-4-phenylpiperidin-1-yl)-3-oxopropyl]phenyl]methyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(Cc2ccc(CCC(=O)N3CCC(O)(c4ccccc4)CC3)cc2)=C(C)C1=O |
| InChI | InChI=1S/C30H33NO6/c1-20-24(27(34)29(37-3)28(36-2)26(20)33)19-22-11-9-21(10-12-22)13-14-25(32)31-17-15-30(35,16-18-31)23-7-5-4-6-8-23/h4-12,35H,13-19H2,1-3H3 |
| InChIKey | CGKOYCGAWFCJAU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|