C29H38N2O6 — CID 20633282
1-[3-[4-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenyl]propanoyl]-N,N-diethylpiperidine-3-carboxamide (PubChem CID 20633282) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is 1-[3-[4-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenyl]propanoyl]-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-[3-[4-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenyl]propanoyl]-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 20633282 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 1-[3-[4-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl]phenyl]propanoyl]-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=O)CCc2ccc(CC3=C(C)C(=O)C(OC)=C(OC)C3=O)cc2)C1 |
| InChI | InChI=1S/C29H38N2O6/c1-6-30(7-2)29(35)22-9-8-16-31(18-22)24(32)15-14-20-10-12-21(13-11-20)17-23-19(3)25(33)27(36-4)28(37-5)26(23)34/h10-13,22H,6-9,14-18H2,1-5H3 |
| InChIKey | AMUBHPDYTFBVSO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|