C11H8ClFN2O2S — CID 22325498
5-(2-chloro-5-fluorophenyl)-4-hydroxy-2-methylsulfanyl-1H-pyrimidin-6-one (PubChem CID 22325498) has the molecular formula C11H8ClFN2O2S and a molecular weight of 286.72 g/mol. Its IUPAC name is 5-(2-chloro-5-fluorophenyl)-4-hydroxy-2-methylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 5-(2-chloro-5-fluorophenyl)-4-hydroxy-2-methylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 22325498 |
| Molecular Formula | C11H8ClFN2O2S |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 5-(2-chloro-5-fluorophenyl)-4-hydroxy-2-methylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CSc1nc(O)c(-c2cc(F)ccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C11H8ClFN2O2S/c1-18-11-14-9(16)8(10(17)15-11)6-4-5(13)2-3-7(6)12/h2-4H,1H3,(H2,14,15,16,17) |
| InChIKey | LGNNBZBGOKDUJK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |