C11H13NO4 — CID 22326424
2-amino-5,6-dihydroxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid (PubChem CID 22326424) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-amino-5,6-dihydroxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
| Compound Name | 2-amino-5,6-dihydroxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 22326424 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-amino-5,6-dihydroxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
| SMILES | NC1(C(=O)O)CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C11H13NO4/c12-11(10(15)16)4-3-7-6(5-11)1-2-8(13)9(7)14/h1-2,13-14H,3-5,12H2,(H,15,16) |
| InChIKey | VVUOJPYDSRHPMO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|