About 3-hydroxyoctanedioic acid
3-hydroxyoctanedioic acid (PubChem CID 22328017) has the molecular formula C8H14O5
and a molecular weight of 190.19 g/mol. Its IUPAC name is 3-hydroxyoctanedioic acid.
Molecular Properties
| Compound Name | 3-hydroxyoctanedioic acid |
| PubChem CID | 22328017 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 3-hydroxyoctanedioic acid |
| SMILES | O=C(O)CCCCC(O)CC(=O)O |
| InChI | InChI=1S/C8H14O5/c9-6(5-8(12)13)3-1-2-4-7(10)11/h6,9H,1-5H2,(H,10,11)(H,12,13) |
| InChIKey | ARJZZFJXSNJKGR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyoctanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyoctanedioic acid?
The IUPAC name of 3-hydroxyoctanedioic acid (CID 22328017) is 3-hydroxyoctanedioic acid.
What is the SMILES notation for 3-hydroxyoctanedioic acid?
The canonical SMILES for 3-hydroxyoctanedioic acid is O=C(O)CCCCC(O)CC(=O)O.
What is the InChIKey of 3-hydroxyoctanedioic acid?
The InChIKey is ARJZZFJXSNJKGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5/c9-6(5-8(12)13)3-1-2-4-7(10)11/h6,9H,1-5H2,(H,10,11)(H,12,13).
What are the key properties of 3-hydroxyoctanedioic acid?
3-hydroxyoctanedioic acid has a molecular weight of 190.19 g/mol, XLogP of 0.47, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyoctanedioic acid is sourced from PubChem (CID 22328017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).