C9H9ClNS+ — CID 22332834
5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium (PubChem CID 22332834) has the molecular formula C9H9ClNS+ and a molecular weight of 198.70 g/mol. Its IUPAC name is 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium.
| Compound Name | 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium |
|---|---|
| PubChem CID | 22332834 |
| Molecular Formula | C9H9ClNS+ |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium |
| SMILES | Cc1c2cc(Cl)ccc2s[n+]1C |
| InChI | InChI=1S/C9H9ClNS/c1-6-8-5-7(10)3-4-9(8)12-11(6)2/h3-5H,1-2H3/q+1 |
| InChIKey | LQTGHVTVUDDJEZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|