About 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium
5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium (PubChem CID 22332834) has the molecular formula C9H9ClNS+
and a molecular weight of 198.70 g/mol. Its IUPAC name is 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium.
Molecular Properties
| Compound Name | 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium |
| PubChem CID | 22332834 |
| Molecular Formula | C9H9ClNS+ |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium |
| SMILES | Cc1c2cc(Cl)ccc2s[n+]1C |
| InChI | InChI=1S/C9H9ClNS/c1-6-8-5-7(10)3-4-9(8)12-11(6)2/h3-5H,1-2H3/q+1 |
| InChIKey | LQTGHVTVUDDJEZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium?
The IUPAC name of 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium (CID 22332834) is 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium.
What is the SMILES notation for 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium?
The canonical SMILES for 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium is Cc1c2cc(Cl)ccc2s[n+]1C.
What is the InChIKey of 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium?
The InChIKey is LQTGHVTVUDDJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClNS/c1-6-8-5-7(10)3-4-9(8)12-11(6)2/h3-5H,1-2H3/q+1.
What are the key properties of 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium?
5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium has a molecular weight of 198.70 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dimethyl-1,2-benzothiazol-2-ium is sourced from PubChem (CID 22332834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).