C16H18N4S — CID 22335547
N-cyclohexyl-6-pyridin-2-ylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 22335547) has the molecular formula C16H18N4S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-cyclohexyl-6-pyridin-2-ylimidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | N-cyclohexyl-6-pyridin-2-ylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 22335547 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-cyclohexyl-6-pyridin-2-ylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | c1ccc(-c2nc3sccn3c2NC2CCCCC2)nc1 |
| InChI | InChI=1S/C16H18N4S/c1-2-6-12(7-3-1)18-15-14(13-8-4-5-9-17-13)19-16-20(15)10-11-21-16/h4-5,8-12,18H,1-3,6-7H2 |
| InChIKey | DWYNLJQDBCJIRE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |