C16H15FN4O — CID 22337656
1-[(2-fluorophenyl)methyl]-3-(1-methylindazol-4-yl)urea (PubChem CID 22337656) has the molecular formula C16H15FN4O and a molecular weight of 298.32 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-(1-methylindazol-4-yl)urea.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-(1-methylindazol-4-yl)urea |
|---|---|
| PubChem CID | 22337656 |
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-(1-methylindazol-4-yl)urea |
| SMILES | Cn1ncc2c(NC(=O)NCc3ccccc3F)cccc21 |
| InChI | InChI=1S/C16H15FN4O/c1-21-15-8-4-7-14(12(15)10-19-21)20-16(22)18-9-11-5-2-3-6-13(11)17/h2-8,10H,9H2,1H3,(H2,18,20,22) |
| InChIKey | GBAYWBKTRQWXNF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |