C18H40O3Si2 — CID 22339170
6,8-bis[[ethyl(dimethyl)silyl]oxy]-5,5-dimethyloctan-4-one (PubChem CID 22339170) has the molecular formula C18H40O3Si2 and a molecular weight of 360.69 g/mol. Its IUPAC name is 6,8-bis[[ethyl(dimethyl)silyl]oxy]-5,5-dimethyloctan-4-one.
| Compound Name | 6,8-bis[[ethyl(dimethyl)silyl]oxy]-5,5-dimethyloctan-4-one |
|---|---|
| PubChem CID | 22339170 |
| Molecular Formula | C18H40O3Si2 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 6,8-bis[[ethyl(dimethyl)silyl]oxy]-5,5-dimethyloctan-4-one |
| SMILES | CCCC(=O)C(C)(C)C(CCO[Si](C)(C)CC)O[Si](C)(C)CC |
| InChI | InChI=1S/C18H40O3Si2/c1-10-13-16(19)18(4,5)17(21-23(8,9)12-3)14-15-20-22(6,7)11-2/h17H,10-15H2,1-9H3 |
| InChIKey | MBFPGDYPEOLEGE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|