C17H12I3NO5 — CID 22341992
4-(3-acetyl-5-ethyl-2,4,6-triiodophenyl)-2-nitrobenzoic acid (PubChem CID 22341992) has the molecular formula C17H12I3NO5 and a molecular weight of 691.00 g/mol. Its IUPAC name is 4-(3-acetyl-5-ethyl-2,4,6-triiodophenyl)-2-nitrobenzoic acid.
| Compound Name | 4-(3-acetyl-5-ethyl-2,4,6-triiodophenyl)-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 22341992 |
| Molecular Formula | C17H12I3NO5 |
| Molecular Weight | 691.00 g/mol |
| Exact Mass | 690.78 |
| IUPAC Name | 4-(3-acetyl-5-ethyl-2,4,6-triiodophenyl)-2-nitrobenzoic acid |
| SMILES | CCc1c(I)c(C(C)=O)c(I)c(-c2ccc(C(=O)O)c([N+](=O)[O-])c2)c1I |
| InChI | InChI=1S/C17H12I3NO5/c1-3-9-14(18)12(7(2)22)16(20)13(15(9)19)8-4-5-10(17(23)24)11(6-8)21(25)26/h4-6H,3H2,1-2H3,(H,23,24) |
| InChIKey | HTTVRDXKZJKKLT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.00 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|