C19H19NO6S — CID 174772418
4-methyl-2-[4-(2-methylpropylsulfanyl)-3-nitrophenyl]benzene-1,3-dicarboxylic acid (PubChem CID 174772418) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is 4-methyl-2-[4-(2-methylpropylsulfanyl)-3-nitrophenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-methyl-2-[4-(2-methylpropylsulfanyl)-3-nitrophenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174772418 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-methyl-2-[4-(2-methylpropylsulfanyl)-3-nitrophenyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c(-c2ccc(SCC(C)C)c([N+](=O)[O-])c2)c1C(=O)O |
| InChI | InChI=1S/C19H19NO6S/c1-10(2)9-27-15-7-5-12(8-14(15)20(25)26)17-13(18(21)22)6-4-11(3)16(17)19(23)24/h4-8,10H,9H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | YJYSYCJBBPAJMF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|