About CID 22342181
CID 22342181 (PubChem CID 22342181) has the molecular formula C21H18N2O5Si
and a molecular weight of 406.47 g/mol.
Molecular Properties
| Compound Name | CID 22342181 |
| PubChem CID | 22342181 |
| Molecular Formula | C21H18N2O5Si |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | — |
| SMILES | Cc1cccc([Si]OC(c2ccccc2[N+](=O)[O-])c2ccccc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C21H18N2O5Si/c1-14-8-7-13-20(15(14)2)29-28-21(16-9-3-5-11-18(16)22(24)25)17-10-4-6-12-19(17)23(26)27/h3-13,21H,1-2H3 |
| InChIKey | OENFNGQIBZZGKV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 22342181 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22342181?
The IUPAC name of CID 22342181 (CID 22342181) is not available.
What is the SMILES notation for CID 22342181?
The canonical SMILES for CID 22342181 is Cc1cccc([Si]OC(c2ccccc2[N+](=O)[O-])c2ccccc2[N+](=O)[O-])c1C.
What is the InChIKey of CID 22342181?
The InChIKey is OENFNGQIBZZGKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O5Si/c1-14-8-7-13-20(15(14)2)29-28-21(16-9-3-5-11-18(16)22(24)25)17-10-4-6-12-19(17)23(26)27/h3-13,21H,1-2H3.
What are the key properties of CID 22342181?
CID 22342181 has a molecular weight of 406.47 g/mol, XLogP of 4.17, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22342181 is sourced from PubChem (CID 22342181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).