C30H37N3O3 — CID 22344223
N-(1-azabicyclo[2.2.2]octan-3-yl)-3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzamide (PubChem CID 22344223) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzamide |
|---|---|
| PubChem CID | 22344223 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-3-(6-methoxy-3,3,8,8-tetramethyl-4,9-dihydrofuro[2,3-h]isoquinolin-1-yl)benzamide |
| SMILES | COc1cc2c(c3c1OC(C)(C)C3)C(c1cccc(C(=O)NC3CN4CCC3CC4)c1)=NC(C)(C)C2 |
| InChI | InChI=1S/C30H37N3O3/c1-29(2)15-21-14-24(35-5)27-22(16-30(3,4)36-27)25(21)26(32-29)19-7-6-8-20(13-19)28(34)31-23-17-33-11-9-18(23)10-12-33/h6-8,13-14,18,23H,9-12,15-17H2,1-5H3,(H,31,34) |
| InChIKey | RRBDEZICXXZQGT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |