About dimethylsulfoxonium
dimethylsulfoxonium (PubChem CID 22345572) has the molecular formula C2H7OS+
and a molecular weight of 79.14 g/mol.
Molecular Properties
| Compound Name | dimethylsulfoxonium |
| PubChem CID | 22345572 |
| Molecular Formula | C2H7OS+ |
| Molecular Weight | 79.14 g/mol |
| Exact Mass | 79.02 |
| IUPAC Name | — |
| SMILES | C[SH+](C)=O |
| InChI | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3/p+1 |
| InChIKey | IAZDPXIOMUYVGZ-UHFFFAOYSA-O |
| XLogP | -0.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 79.14 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylsulfoxonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsulfoxonium?
The IUPAC name of dimethylsulfoxonium (CID 22345572) is not available.
What is the SMILES notation for dimethylsulfoxonium?
The canonical SMILES for dimethylsulfoxonium is C[SH+](C)=O.
What is the InChIKey of dimethylsulfoxonium?
The InChIKey is IAZDPXIOMUYVGZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H6OS/c1-4(2)3/h1-2H3/p+1.
What are the key properties of dimethylsulfoxonium?
dimethylsulfoxonium has a molecular weight of 79.14 g/mol, XLogP of -0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsulfoxonium is sourced from PubChem (CID 22345572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).