C10H6ClF3N2O2 — CID 22347996
6-chloro-1-(2,2,2-trifluoroethyl)quinazoline-2,4-dione (PubChem CID 22347996) has the molecular formula C10H6ClF3N2O2 and a molecular weight of 278.62 g/mol. Its IUPAC name is 6-chloro-1-(2,2,2-trifluoroethyl)quinazoline-2,4-dione.
| Compound Name | 6-chloro-1-(2,2,2-trifluoroethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 22347996 |
| Molecular Formula | C10H6ClF3N2O2 |
| Molecular Weight | 278.62 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 6-chloro-1-(2,2,2-trifluoroethyl)quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CC(F)(F)F)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H6ClF3N2O2/c11-5-1-2-7-6(3-5)8(17)15-9(18)16(7)4-10(12,13)14/h1-3H,4H2,(H,15,17,18) |
| InChIKey | QEBRKKXXTUCDKD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.62 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |