C9H3Br3N4 — CID 22359
2-[(2,4,6-tribromophenyl)diazenyl]propanedinitrile (PubChem CID 22359) has the molecular formula C9H3Br3N4 and a molecular weight of 406.86 g/mol. Its IUPAC name is 2-[(2,4,6-tribromophenyl)diazenyl]propanedinitrile.
| Compound Name | 2-[(2,4,6-tribromophenyl)diazenyl]propanedinitrile |
|---|---|
| PubChem CID | 22359 |
| Molecular Formula | C9H3Br3N4 |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 403.79 |
| IUPAC Name | 2-[(2,4,6-tribromophenyl)diazenyl]propanedinitrile |
| SMILES | N#CC(C#N)/N=N/c1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C9H3Br3N4/c10-5-1-7(11)9(8(12)2-5)16-15-6(3-13)4-14/h1-2,6H/b16-15+ |
| InChIKey | GBBYEOCABKQYTL-FOCLMDBBSA-N |
| XLogP | 4.47 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|