2,4-dibromobenzenediazonium chloride

C6H3Br2ClN2 — CID 14199096

IUPAC2,4-dibromobenzenediazonium chloride
SMILESN#[N+]c1ccc(Br)cc1Br.[Cl-]
InChIInChI=1S/C6H3Br2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3H;1H/q+1;/p-1
InChIKeyWAFOJBIHDMXVEY-UHFFFAOYSA-M
MW298.37 g/mol
LogP0.70
Rot. Bonds

About 2,4-dibromobenzenediazonium chloride

2,4-dibromobenzenediazonium chloride (PubChem CID 14199096) has the molecular formula C6H3Br2ClN2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 2,4-dibromobenzenediazonium chloride.

Molecular Properties

Compound Name2,4-dibromobenzenediazonium chloride
PubChem CID14199096
Molecular FormulaC6H3Br2ClN2
Molecular Weight298.37 g/mol
Exact Mass295.84
IUPAC Name2,4-dibromobenzenediazonium chloride
SMILESN#[N+]c1ccc(Br)cc1Br.[Cl-]
InChIInChI=1S/C6H3Br2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3H;1H/q+1;/p-1
InChIKeyWAFOJBIHDMXVEY-UHFFFAOYSA-M
XLogP0.70
TPSA28.15 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.37
LogP ≤ 50.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}

Analyze 2,4-dibromobenzenediazonium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dibromobenzenediazonium chloride?
The IUPAC name of 2,4-dibromobenzenediazonium chloride (CID 14199096) is 2,4-dibromobenzenediazonium chloride.
What is the SMILES notation for 2,4-dibromobenzenediazonium chloride?
The canonical SMILES for 2,4-dibromobenzenediazonium chloride is N#[N+]c1ccc(Br)cc1Br.[Cl-].
What is the InChIKey of 2,4-dibromobenzenediazonium chloride?
The InChIKey is WAFOJBIHDMXVEY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H3Br2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3H;1H/q+1;/p-1.
What are the key properties of 2,4-dibromobenzenediazonium chloride?
2,4-dibromobenzenediazonium chloride has a molecular weight of 298.37 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromobenzenediazonium chloride is sourced from PubChem (CID 14199096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).