C18H36N2NaO4+ — CID 22359060
sodium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid (PubChem CID 22359060) has the molecular formula C18H36N2NaO4+ and a molecular weight of 367.49 g/mol. Its IUPAC name is sodium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid.
| Compound Name | sodium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 22359060 |
| Molecular Formula | C18H36N2NaO4+ |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | sodium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid |
| SMILES | CCCCCCCCCCCC(=O)NCCN(CCO)CC(=O)O.[Na+] |
| InChI | InChI=1S/C18H36N2O4.Na/c1-2-3-4-5-6-7-8-9-10-11-17(22)19-12-13-20(14-15-21)16-18(23)24;/h21H,2-16H2,1H3,(H,19,22)(H,23,24);/q;+1 |
| InChIKey | HVFAVOFILADWEZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|