C18H40N3O4+ — CID 23173744
azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid (PubChem CID 23173744) has the molecular formula C18H40N3O4+ and a molecular weight of 362.54 g/mol. Its IUPAC name is azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid.
| Compound Name | azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 23173744 |
| Molecular Formula | C18H40N3O4+ |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid |
| SMILES | CCCCCCCCCCCC(=O)NCCN(CCO)CC(=O)O.[NH4+] |
| InChI | InChI=1S/C18H36N2O4.H3N/c1-2-3-4-5-6-7-8-9-10-11-17(22)19-12-13-20(14-15-21)16-18(23)24;/h21H,2-16H2,1H3,(H,19,22)(H,23,24);1H3/p+1 |
| InChIKey | FBUIZEKHCRBPMJ-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|