azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid

C18H40N3O4+ — CID 23173744

IUPACazanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid
SMILESCCCCCCCCCCCC(=O)NCCN(CCO)CC(=O)O.[NH4+]
InChIInChI=1S/C18H36N2O4.H3N/c1-2-3-4-5-6-7-8-9-10-11-17(22)19-12-13-20(14-15-21)16-18(23)24;/h21H,2-16H2,1H3,(H,19,22)(H,23,24);1H3/p+1
InChIKeyFBUIZEKHCRBPMJ-UHFFFAOYSA-O
MW362.54 g/mol
LogP2.78
Rot. Bonds17

About azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid

azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid (PubChem CID 23173744) has the molecular formula C18H40N3O4+ and a molecular weight of 362.54 g/mol. Its IUPAC name is azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid.

Molecular Properties

Compound Nameazanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid
PubChem CID23173744
Molecular FormulaC18H40N3O4+
Molecular Weight362.54 g/mol
Exact Mass362.30
IUPAC Nameazanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid
SMILESCCCCCCCCCCCC(=O)NCCN(CCO)CC(=O)O.[NH4+]
InChIInChI=1S/C18H36N2O4.H3N/c1-2-3-4-5-6-7-8-9-10-11-17(22)19-12-13-20(14-15-21)16-18(23)24;/h21H,2-16H2,1H3,(H,19,22)(H,23,24);1H3/p+1
InChIKeyFBUIZEKHCRBPMJ-UHFFFAOYSA-O
XLogP2.78
TPSA126.37 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds17
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500362.54
LogP ≤ 52.78
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid?
The IUPAC name of azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid (CID 23173744) is azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid.
What is the SMILES notation for azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid?
The canonical SMILES for azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid is CCCCCCCCCCCC(=O)NCCN(CCO)CC(=O)O.[NH4+].
What is the InChIKey of azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid?
The InChIKey is FBUIZEKHCRBPMJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H36N2O4.H3N/c1-2-3-4-5-6-7-8-9-10-11-17(22)19-12-13-20(14-15-21)16-18(23)24;/h21H,2-16H2,1H3,(H,19,22)(H,23,24);1H3/p+1.
What are the key properties of azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid?
azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid has a molecular weight of 362.54 g/mol, XLogP of 2.78, 17 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2-[2-(dodecanoylamino)ethyl-(2-hydroxyethyl)amino]acetic acid is sourced from PubChem (CID 23173744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).