C19H14N3O6S2- — CID 2235934
2-[[(5E)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]-4-nitrophenolate (PubChem CID 2235934) has the molecular formula C19H14N3O6S2- and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-[[(5E)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]-4-nitrophenolate.
| Compound Name | 2-[[(5E)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 2235934 |
| Molecular Formula | C19H14N3O6S2- |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2-[[(5E)-5-[(2,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]-4-nitrophenolate |
| SMILES | COc1ccc(/C=C2/SC(=S)N(N=Cc3cc([N+](=O)[O-])ccc3[O-])C2=O)c(OC)c1 |
| InChI | InChI=1S/C19H15N3O6S2/c1-27-14-5-3-11(16(9-14)28-2)8-17-18(24)21(19(29)30-17)20-10-12-7-13(22(25)26)4-6-15(12)23/h3-10,23H,1-2H3/p-1/b17-8+,20-10? |
| InChIKey | RYYLHTBDRRUJCP-PTFJCWKUSA-M |
| XLogP | 2.92 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|